C10H18Br2N2O2Si — CID 156708294
2-[(4,5-dibromo-2-methoxyimidazol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 156708294) has the molecular formula C10H18Br2N2O2Si and a molecular weight of 386.16 g/mol. Its IUPAC name is 2-[(4,5-dibromo-2-methoxyimidazol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(4,5-dibromo-2-methoxyimidazol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 156708294 |
| Molecular Formula | C10H18Br2N2O2Si |
| Molecular Weight | 386.16 g/mol |
| Exact Mass | 383.95 |
| IUPAC Name | 2-[(4,5-dibromo-2-methoxyimidazol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | COc1nc(Br)c(Br)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C10H18Br2N2O2Si/c1-15-10-13-8(11)9(12)14(10)7-16-5-6-17(2,3)4/h5-7H2,1-4H3 |
| InChIKey | KYAXQIAVVPAUOO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.16 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|