C14H25BrN2O3Si — CID 87549653
5-bromo-2-(3-methoxypropyl)-3-(2-trimethylsilylethoxymethyl)imidazole-4-carbaldehyde (PubChem CID 87549653) has the molecular formula C14H25BrN2O3Si and a molecular weight of 377.36 g/mol. Its IUPAC name is 5-bromo-2-(3-methoxypropyl)-3-(2-trimethylsilylethoxymethyl)imidazole-4-carbaldehyde.
| Compound Name | 5-bromo-2-(3-methoxypropyl)-3-(2-trimethylsilylethoxymethyl)imidazole-4-carbaldehyde |
|---|---|
| PubChem CID | 87549653 |
| Molecular Formula | C14H25BrN2O3Si |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 5-bromo-2-(3-methoxypropyl)-3-(2-trimethylsilylethoxymethyl)imidazole-4-carbaldehyde |
| SMILES | COCCCc1nc(Br)c(C=O)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C14H25BrN2O3Si/c1-19-7-5-6-13-16-14(15)12(10-18)17(13)11-20-8-9-21(2,3)4/h10H,5-9,11H2,1-4H3 |
| InChIKey | CXYPDOGSDYIEEZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|