C10H15Br2F3N2OSi — CID 123200798
2-[[2,5-dibromo-4-(trifluoromethyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 123200798) has the molecular formula C10H15Br2F3N2OSi and a molecular weight of 424.13 g/mol. Its IUPAC name is 2-[[2,5-dibromo-4-(trifluoromethyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2,5-dibromo-4-(trifluoromethyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 123200798 |
| Molecular Formula | C10H15Br2F3N2OSi |
| Molecular Weight | 424.13 g/mol |
| Exact Mass | 421.93 |
| IUPAC Name | 2-[[2,5-dibromo-4-(trifluoromethyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c(Br)nc(C(F)(F)F)c1Br |
| InChI | InChI=1S/C10H15Br2F3N2OSi/c1-19(2,3)5-4-18-6-17-8(11)7(10(13,14)15)16-9(17)12/h4-6H2,1-3H3 |
| InChIKey | QPQGKLBEPGYASY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.13 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|