C10H16BrF3N2OSi — CID 177304121
2-[[3-bromo-5-(trifluoromethyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 177304121) has the molecular formula C10H16BrF3N2OSi and a molecular weight of 345.24 g/mol. Its IUPAC name is 2-[[3-bromo-5-(trifluoromethyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-bromo-5-(trifluoromethyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 177304121 |
| Molecular Formula | C10H16BrF3N2OSi |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 2-[[3-bromo-5-(trifluoromethyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1nc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C10H16BrF3N2OSi/c1-18(2,3)5-4-17-7-16-8(10(12,13)14)6-9(11)15-16/h6H,4-5,7H2,1-3H3 |
| InChIKey | LZDOPBHHDOBNKI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|