C10H16BrN3OSi — CID 135086401
3-bromo-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carbonitrile (PubChem CID 135086401) has the molecular formula C10H16BrN3OSi and a molecular weight of 302.25 g/mol. Its IUPAC name is 3-bromo-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carbonitrile.
| Compound Name | 3-bromo-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 135086401 |
| Molecular Formula | C10H16BrN3OSi |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 3-bromo-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1nc(Br)cc1C#N |
| InChI | InChI=1S/C10H16BrN3OSi/c1-16(2,3)5-4-15-8-14-9(7-12)6-10(11)13-14/h6H,4-5,8H2,1-3H3 |
| InChIKey | YTEFTBJVQRKIMM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|