C16H21N3OSSi — CID 135066496
5-phenylsulfanyl-1-(2-trimethylsilylethoxymethyl)pyrazole-3-carbonitrile (PubChem CID 135066496) has the molecular formula C16H21N3OSSi and a molecular weight of 331.52 g/mol. Its IUPAC name is 5-phenylsulfanyl-1-(2-trimethylsilylethoxymethyl)pyrazole-3-carbonitrile.
| Compound Name | 5-phenylsulfanyl-1-(2-trimethylsilylethoxymethyl)pyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 135066496 |
| Molecular Formula | C16H21N3OSSi |
| Molecular Weight | 331.52 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 5-phenylsulfanyl-1-(2-trimethylsilylethoxymethyl)pyrazole-3-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1nc(C#N)cc1Sc1ccccc1 |
| InChI | InChI=1S/C16H21N3OSSi/c1-22(2,3)10-9-20-13-19-16(11-14(12-17)18-19)21-15-7-5-4-6-8-15/h4-8,11H,9-10,13H2,1-3H3 |
| InChIKey | XLNGLRGHAZYQSN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|