C17H29N3OSiSn — CID 168730347
trimethyl-[2-[(3-phenyl-5-trimethylstannyl-1,2,4-triazol-1-yl)methoxy]ethyl]silane (PubChem CID 168730347) has the molecular formula C17H29N3OSiSn and a molecular weight of 438.24 g/mol. Its IUPAC name is trimethyl-[2-[(3-phenyl-5-trimethylstannyl-1,2,4-triazol-1-yl)methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[(3-phenyl-5-trimethylstannyl-1,2,4-triazol-1-yl)methoxy]ethyl]silane |
|---|---|
| PubChem CID | 168730347 |
| Molecular Formula | C17H29N3OSiSn |
| Molecular Weight | 438.24 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | trimethyl-[2-[(3-phenyl-5-trimethylstannyl-1,2,4-triazol-1-yl)methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1nc(-c2ccccc2)nc1[Sn](C)(C)C |
| InChI | InChI=1S/C14H20N3OSi.3CH3.Sn/c1-19(2,3)10-9-18-12-17-11-15-14(16-17)13-7-5-4-6-8-13;;;;/h4-8H,9-10,12H2,1-3H3;3*1H3; |
| InChIKey | GMIWBHUXZAPVJB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.24 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|