C14H20BrN3O3SSi — CID 153356807
2-[[5-(benzenesulfonyl)-3-bromo-1,2,4-triazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 153356807) has the molecular formula C14H20BrN3O3SSi and a molecular weight of 418.39 g/mol. Its IUPAC name is 2-[[5-(benzenesulfonyl)-3-bromo-1,2,4-triazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-(benzenesulfonyl)-3-bromo-1,2,4-triazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 153356807 |
| Molecular Formula | C14H20BrN3O3SSi |
| Molecular Weight | 418.39 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | 2-[[5-(benzenesulfonyl)-3-bromo-1,2,4-triazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1nc(Br)nc1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H20BrN3O3SSi/c1-23(2,3)10-9-21-11-18-14(16-13(15)17-18)22(19,20)12-7-5-4-6-8-12/h4-8H,9-11H2,1-3H3 |
| InChIKey | KJDCYCCGQCOQPM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|