C14H21BrN4O2SSi — CID 153357237
2-[[3-bromo-5-(phenylsulfonimidoyl)-1,2,4-triazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 153357237) has the molecular formula C14H21BrN4O2SSi and a molecular weight of 417.41 g/mol. Its IUPAC name is 2-[[3-bromo-5-(phenylsulfonimidoyl)-1,2,4-triazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-bromo-5-(phenylsulfonimidoyl)-1,2,4-triazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 153357237 |
| Molecular Formula | C14H21BrN4O2SSi |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | 2-[[3-bromo-5-(phenylsulfonimidoyl)-1,2,4-triazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | [H]N=S(=O)(c1ccccc1)c1nc(Br)nn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C14H21BrN4O2SSi/c1-23(2,3)10-9-21-11-19-14(17-13(15)18-19)22(16,20)12-7-5-4-6-8-12/h4-8,16H,9-11H2,1-3H3 |
| InChIKey | SFLXWDMMTMFMAE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|