C15H23N3O3SSi — CID 170992405
2-[[4-(benzenesulfonylmethyl)triazol-2-yl]methoxy]ethyl-trimethylsilane (PubChem CID 170992405) has the molecular formula C15H23N3O3SSi and a molecular weight of 353.52 g/mol. Its IUPAC name is 2-[[4-(benzenesulfonylmethyl)triazol-2-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-(benzenesulfonylmethyl)triazol-2-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 170992405 |
| Molecular Formula | C15H23N3O3SSi |
| Molecular Weight | 353.52 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 2-[[4-(benzenesulfonylmethyl)triazol-2-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1ncc(CS(=O)(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C15H23N3O3SSi/c1-23(2,3)10-9-21-13-18-16-11-14(17-18)12-22(19,20)15-7-5-4-6-8-15/h4-8,11H,9-10,12-13H2,1-3H3 |
| InChIKey | AYSLZKUBMDLYGR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.52 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|