C10H21N3O4SSi — CID 123264105
[2-(2-trimethylsilylethoxymethyl)triazol-4-yl]methyl methanesulfonate (PubChem CID 123264105) has the molecular formula C10H21N3O4SSi and a molecular weight of 307.45 g/mol. Its IUPAC name is [2-(2-trimethylsilylethoxymethyl)triazol-4-yl]methyl methanesulfonate.
| Compound Name | [2-(2-trimethylsilylethoxymethyl)triazol-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 123264105 |
| Molecular Formula | C10H21N3O4SSi |
| Molecular Weight | 307.45 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | [2-(2-trimethylsilylethoxymethyl)triazol-4-yl]methyl methanesulfonate |
| SMILES | C[Si](C)(C)CCOCn1ncc(COS(C)(=O)=O)n1 |
| InChI | InChI=1S/C10H21N3O4SSi/c1-18(14,15)17-8-10-7-11-13(12-10)9-16-5-6-19(2,3)4/h7H,5-6,8-9H2,1-4H3 |
| InChIKey | YADIJYAOULXPDT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.45 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|