C14H28BN3O3Si — CID 156678796
trimethyl-[2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazol-2-yl]methoxy]ethyl]silane (PubChem CID 156678796) has the molecular formula C14H28BN3O3Si and a molecular weight of 325.29 g/mol. Its IUPAC name is trimethyl-[2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazol-2-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazol-2-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 156678796 |
| Molecular Formula | C14H28BN3O3Si |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | trimethyl-[2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazol-2-yl]methoxy]ethyl]silane |
| SMILES | CC1(C)OB(c2cnn(COCC[Si](C)(C)C)n2)OC1(C)C |
| InChI | InChI=1S/C14H28BN3O3Si/c1-13(2)14(3,4)21-15(20-13)12-10-16-18(17-12)11-19-8-9-22(5,6)7/h10H,8-9,11H2,1-7H3 |
| InChIKey | HFQDXXAXRCEXLA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|