C19H31BN2O3Si — CID 58137222
trimethyl-[2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazol-1-yl]methoxy]ethyl]silane (PubChem CID 58137222) has the molecular formula C19H31BN2O3Si and a molecular weight of 374.37 g/mol. Its IUPAC name is trimethyl-[2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 58137222 |
| Molecular Formula | C19H31BN2O3Si |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | trimethyl-[2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazol-1-yl]methoxy]ethyl]silane |
| SMILES | CC1(C)OB(c2ccc3c(c2)ncn3COCC[Si](C)(C)C)OC1(C)C |
| InChI | InChI=1S/C19H31BN2O3Si/c1-18(2)19(3,4)25-20(24-18)15-8-9-17-16(12-15)21-13-22(17)14-23-10-11-26(5,6)7/h8-9,12-13H,10-11,14H2,1-7H3 |
| InChIKey | KWOYHFAZDBIHTK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|