C23H38BNO4Si — CID 56850686
2-[[2-(ethoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 56850686) has the molecular formula C23H38BNO4Si and a molecular weight of 431.46 g/mol. Its IUPAC name is 2-[[2-(ethoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-(ethoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 56850686 |
| Molecular Formula | C23H38BNO4Si |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | 2-[[2-(ethoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CCOCc1cc2cc(B3OC(C)(C)C(C)(C)O3)ccc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C23H38BNO4Si/c1-9-26-16-20-15-18-14-19(24-28-22(2,3)23(4,5)29-24)10-11-21(18)25(20)17-27-12-13-30(6,7)8/h10-11,14-15H,9,12-13,16-17H2,1-8H3 |
| InChIKey | BZYRWBQXRAIWPA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 41.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|