C22H37BN2O4Si — CID 177353725
2-[[2-[(1R)-1-methoxyethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 177353725) has the molecular formula C22H37BN2O4Si and a molecular weight of 432.45 g/mol. Its IUPAC name is 2-[[2-[(1R)-1-methoxyethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-[(1R)-1-methoxyethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 177353725 |
| Molecular Formula | C22H37BN2O4Si |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | 2-[[2-[(1R)-1-methoxyethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CO[C@H](C)c1nc2cc(B3OC(C)(C)C(C)(C)O3)ccc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C22H37BN2O4Si/c1-16(26-6)20-24-18-14-17(23-28-21(2,3)22(4,5)29-23)10-11-19(18)25(20)15-27-12-13-30(7,8)9/h10-11,14,16H,12-13,15H2,1-9H3/t16-/m1/s1 |
| InChIKey | ITKKSEAUPNBPQS-MRXNPFEDSA-N |
| XLogP | 4.36 |
| TPSA | 54.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|