C19H32BN3O4Si — CID 163251062
2-[[5-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[4,5-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 163251062) has the molecular formula C19H32BN3O4Si and a molecular weight of 405.38 g/mol. Its IUPAC name is 2-[[5-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[4,5-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[4,5-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 163251062 |
| Molecular Formula | C19H32BN3O4Si |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 2-[[5-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[4,5-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | COc1nc2ncn(COCC[Si](C)(C)C)c2cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H32BN3O4Si/c1-18(2)19(3,4)27-20(26-18)14-11-15-16(22-17(14)24-5)21-12-23(15)13-25-9-10-28(6,7)8/h11-12H,9-10,13H2,1-8H3 |
| InChIKey | FUIYTQKUSMKDMX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 67.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|