C20H31BN2O4Si — CID 175411228
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2-trimethylsilylethoxymethyl)indazole-6-carbaldehyde (PubChem CID 175411228) has the molecular formula C20H31BN2O4Si and a molecular weight of 402.38 g/mol. Its IUPAC name is 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2-trimethylsilylethoxymethyl)indazole-6-carbaldehyde.
| Compound Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2-trimethylsilylethoxymethyl)indazole-6-carbaldehyde |
|---|---|
| PubChem CID | 175411228 |
| Molecular Formula | C20H31BN2O4Si |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2-trimethylsilylethoxymethyl)indazole-6-carbaldehyde |
| SMILES | CC1(C)OB(c2cc3cnn(COCC[Si](C)(C)C)c3cc2C=O)OC1(C)C |
| InChI | InChI=1S/C20H31BN2O4Si/c1-19(2)20(3,4)27-21(26-19)17-10-15-12-22-23(18(15)11-16(17)13-24)14-25-8-9-28(5,6)7/h10-13H,8-9,14H2,1-7H3 |
| InChIKey | JEJWNADODMZTRW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|