C19H31BN4O4Si — CID 131734179
1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-(2-trimethylsilylethoxymethyl)tetrazol-5-one (PubChem CID 131734179) has the molecular formula C19H31BN4O4Si and a molecular weight of 418.38 g/mol. Its IUPAC name is 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-(2-trimethylsilylethoxymethyl)tetrazol-5-one.
| Compound Name | 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-(2-trimethylsilylethoxymethyl)tetrazol-5-one |
|---|---|
| PubChem CID | 131734179 |
| Molecular Formula | C19H31BN4O4Si |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-(2-trimethylsilylethoxymethyl)tetrazol-5-one |
| SMILES | CC1(C)OB(c2ccc(-n3nnn(COCC[Si](C)(C)C)c3=O)cc2)OC1(C)C |
| InChI | InChI=1S/C19H31BN4O4Si/c1-18(2)19(3,4)28-20(27-18)15-8-10-16(11-9-15)24-17(25)23(21-22-24)14-26-12-13-29(5,6)7/h8-11H,12-14H2,1-7H3 |
| InChIKey | OZBQWQSDLCUDMQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 80.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|