C15H20BN3O3 — CID 174253438
4-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-triazol-3-one (PubChem CID 174253438) has the molecular formula C15H20BN3O3 and a molecular weight of 301.16 g/mol. Its IUPAC name is 4-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-triazol-3-one.
| Compound Name | 4-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 174253438 |
| Molecular Formula | C15H20BN3O3 |
| Molecular Weight | 301.16 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 4-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-triazol-3-one |
| SMILES | Cn1cnn(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)c1=O |
| InChI | InChI=1S/C15H20BN3O3/c1-14(2)15(3,4)22-16(21-14)11-6-8-12(9-7-11)19-13(20)18(5)10-17-19/h6-10H,1-5H3 |
| InChIKey | FRGAJSFUGCLWOT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 58.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.16 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|