C17H23BN2O3 — CID 59232418
2-methyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dihydropyridazin-3-one (PubChem CID 59232418) has the molecular formula C17H23BN2O3 and a molecular weight of 314.19 g/mol. Its IUPAC name is 2-methyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dihydropyridazin-3-one.
| Compound Name | 2-methyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dihydropyridazin-3-one |
|---|---|
| PubChem CID | 59232418 |
| Molecular Formula | C17H23BN2O3 |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 2-methyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dihydropyridazin-3-one |
| SMILES | CN1N=C(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)CCC1=O |
| InChI | InChI=1S/C17H23BN2O3/c1-16(2)17(3,4)23-18(22-16)13-8-6-12(7-9-13)14-10-11-15(21)20(5)19-14/h6-9H,10-11H2,1-5H3 |
| InChIKey | HAXMZFDSJLRIEM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|