C15H18BNO2S — CID 151741063
5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-thiazole (PubChem CID 151741063) has the molecular formula C15H18BNO2S and a molecular weight of 287.19 g/mol. Its IUPAC name is 5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-thiazole.
| Compound Name | 5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-thiazole |
|---|---|
| PubChem CID | 151741063 |
| Molecular Formula | C15H18BNO2S |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-thiazole |
| SMILES | CC1(C)OB(c2ccc(-c3ccns3)cc2)OC1(C)C |
| InChI | InChI=1S/C15H18BNO2S/c1-14(2)15(3,4)19-16(18-14)12-7-5-11(6-8-12)13-9-10-17-20-13/h5-10H,1-4H3 |
| InChIKey | RMNSMQHNEQNTMZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|