C17H23BN2O2S — CID 144672248
N,3-dimethyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-thiazol-4-amine (PubChem CID 144672248) has the molecular formula C17H23BN2O2S and a molecular weight of 330.26 g/mol. Its IUPAC name is N,3-dimethyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-thiazol-4-amine.
| Compound Name | N,3-dimethyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-thiazol-4-amine |
|---|---|
| PubChem CID | 144672248 |
| Molecular Formula | C17H23BN2O2S |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | N,3-dimethyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-thiazol-4-amine |
| SMILES | CNc1c(C)nsc1-c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C17H23BN2O2S/c1-11-14(19-6)15(23-20-11)12-7-9-13(10-8-12)18-21-16(2,3)17(4,5)22-18/h7-10,19H,1-6H3 |
| InChIKey | DADIEYDOZIDCAD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|