C25H29BN2O4S — CID 123276904
1-phenylethyl N-[3-methyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-thiazol-4-yl]carbamate (PubChem CID 123276904) has the molecular formula C25H29BN2O4S and a molecular weight of 464.40 g/mol. Its IUPAC name is 1-phenylethyl N-[3-methyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-thiazol-4-yl]carbamate.
| Compound Name | 1-phenylethyl N-[3-methyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-thiazol-4-yl]carbamate |
|---|---|
| PubChem CID | 123276904 |
| Molecular Formula | C25H29BN2O4S |
| Molecular Weight | 464.40 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 1-phenylethyl N-[3-methyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-thiazol-4-yl]carbamate |
| SMILES | Cc1nsc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)c1NC(=O)OC(C)c1ccccc1 |
| InChI | InChI=1S/C25H29BN2O4S/c1-16-21(27-23(29)30-17(2)18-10-8-7-9-11-18)22(33-28-16)19-12-14-20(15-13-19)26-31-24(3,4)25(5,6)32-26/h7-15,17H,1-6H3,(H,27,29) |
| InChIKey | FSFYGRQBYFDFTD-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.40 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|