C11H18BNO2 — CID 176565581
molecular hydrogen;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 176565581) has the molecular formula C11H18BNO2 and a molecular weight of 207.08 g/mol. Its IUPAC name is molecular hydrogen;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | molecular hydrogen;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 176565581 |
| Molecular Formula | C11H18BNO2 |
| Molecular Weight | 207.08 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | molecular hydrogen;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CC1(C)OB(c2ccncc2)OC1(C)C.[H][H] |
| InChI | InChI=1S/C11H16BNO2.H2/c1-10(2)11(3,4)15-12(14-10)9-5-7-13-8-6-9;/h5-8H,1-4H3;1H |
| InChIKey | GVMVHVXBYUDGGW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.08 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|