C10H15ArBN2O2 — CID 159310309
argon;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (PubChem CID 159310309) has the molecular formula C10H15ArBN2O2 and a molecular weight of 246.00 g/mol. Its IUPAC name is argon;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine.
| Compound Name | argon;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
|---|---|
| PubChem CID | 159310309 |
| Molecular Formula | C10H15ArBN2O2 |
| Molecular Weight | 246.00 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | argon;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| SMILES | CC1(C)OB(c2cncnc2)OC1(C)C.[Ar] |
| InChI | InChI=1S/C10H15BN2O2.Ar/c1-9(2)10(3,4)15-11(14-9)8-5-12-7-13-6-8;/h5-7H,1-4H3; |
| InChIKey | LCLJAENYHXCSFT-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.00 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|