C14H17BN2O3 — CID 67055971
5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-1,3-oxazole (PubChem CID 67055971) has the molecular formula C14H17BN2O3 and a molecular weight of 272.11 g/mol. Its IUPAC name is 5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-1,3-oxazole.
| Compound Name | 5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-1,3-oxazole |
|---|---|
| PubChem CID | 67055971 |
| Molecular Formula | C14H17BN2O3 |
| Molecular Weight | 272.11 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-1,3-oxazole |
| SMILES | CC1(C)OB(c2cncc(-c3cnco3)c2)OC1(C)C |
| InChI | InChI=1S/C14H17BN2O3/c1-13(2)14(3,4)20-15(19-13)11-5-10(6-16-7-11)12-8-17-9-18-12/h5-9H,1-4H3 |
| InChIKey | TWOHCXKOXNISKF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.11 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|