C13H18BN5O2 — CID 175811221
3-(2-methyltetrazol-5-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 175811221) has the molecular formula C13H18BN5O2 and a molecular weight of 287.13 g/mol. Its IUPAC name is 3-(2-methyltetrazol-5-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 3-(2-methyltetrazol-5-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 175811221 |
| Molecular Formula | C13H18BN5O2 |
| Molecular Weight | 287.13 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 3-(2-methyltetrazol-5-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | Cn1nnc(-c2cncc(B3OC(C)(C)C(C)(C)O3)c2)n1 |
| InChI | InChI=1S/C13H18BN5O2/c1-12(2)13(3,4)21-14(20-12)10-6-9(7-15-8-10)11-16-18-19(5)17-11/h6-8H,1-5H3 |
| InChIKey | DXJMLGVKNKDISF-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.13 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|