C27H30BN3O2 — CID 162689584
2,9-diethyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-1,10-phenanthroline (PubChem CID 162689584) has the molecular formula C27H30BN3O2 and a molecular weight of 439.37 g/mol. Its IUPAC name is 2,9-diethyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-1,10-phenanthroline.
| Compound Name | 2,9-diethyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 162689584 |
| Molecular Formula | C27H30BN3O2 |
| Molecular Weight | 439.37 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 2,9-diethyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-1,10-phenanthroline |
| SMILES | CCc1ccc2ccc3c(-c4cncc(B5OC(C)(C)C(C)(C)O5)c4)cc(CC)nc3c2n1 |
| InChI | InChI=1S/C27H30BN3O2/c1-7-20-11-9-17-10-12-22-23(14-21(8-2)31-25(22)24(17)30-20)18-13-19(16-29-15-18)28-32-26(3,4)27(5,6)33-28/h9-16H,7-8H2,1-6H3 |
| InChIKey | TZYXLFAWVHKMAE-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.37 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|