C27H24BN3O2 — CID 154660217
2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]-1,10-phenanthroline (PubChem CID 154660217) has the molecular formula C27H24BN3O2 and a molecular weight of 433.32 g/mol. Its IUPAC name is 2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]-1,10-phenanthroline.
| Compound Name | 2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 154660217 |
| Molecular Formula | C27H24BN3O2 |
| Molecular Weight | 433.32 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]-1,10-phenanthroline |
| SMILES | CC1(C)OB(c2ccc3ccc(-c4ccc5ccc6cccnc6c5n4)nc3c2)OC1(C)C |
| InChI | InChI=1S/C27H24BN3O2/c1-26(2)27(3,4)33-28(32-26)20-12-9-17-10-13-21(30-23(17)16-20)22-14-11-19-8-7-18-6-5-15-29-24(18)25(19)31-22/h5-16H,1-4H3 |
| InChIKey | SLSHHVYOTAZYQR-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.32 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|