C40H24N6 — CID 155023309
2-[4-[7-(2-pyrimidin-4-ylquinolin-7-yl)quinolin-2-yl]phenyl]-1,10-phenanthroline (PubChem CID 155023309) has the molecular formula C40H24N6 and a molecular weight of 588.67 g/mol. Its IUPAC name is 2-[4-[7-(2-pyrimidin-4-ylquinolin-7-yl)quinolin-2-yl]phenyl]-1,10-phenanthroline.
| Compound Name | 2-[4-[7-(2-pyrimidin-4-ylquinolin-7-yl)quinolin-2-yl]phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 155023309 |
| Molecular Formula | C40H24N6 |
| Molecular Weight | 588.67 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | 2-[4-[7-(2-pyrimidin-4-ylquinolin-7-yl)quinolin-2-yl]phenyl]-1,10-phenanthroline |
| SMILES | c1cnc2c(c1)ccc1ccc(-c3ccc(-c4ccc5ccc(-c6ccc7ccc(-c8ccncn8)nc7c6)cc5n4)cc3)nc12 |
| InChI | InChI=1S/C40H24N6/c1-2-29-9-10-30-15-17-34(46-40(30)39(29)42-20-1)26-5-3-25(4-6-26)33-16-13-27-7-11-31(22-37(27)44-33)32-12-8-28-14-18-36(45-38(28)23-32)35-19-21-41-24-43-35/h1-24H |
| InChIKey | NVFWLSXALVWZEZ-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.67 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|