C56H34N6 — CID 164780822
2-[6-[7-[2-(4,6-diphenylpyrimidin-2-yl)quinolin-7-yl]quinolin-2-yl]naphthalen-2-yl]-1,10-phenanthroline (PubChem CID 164780822) has the molecular formula C56H34N6 and a molecular weight of 790.93 g/mol. Its IUPAC name is 2-[6-[7-[2-(4,6-diphenylpyrimidin-2-yl)quinolin-7-yl]quinolin-2-yl]naphthalen-2-yl]-1,10-phenanthroline.
| Compound Name | 2-[6-[7-[2-(4,6-diphenylpyrimidin-2-yl)quinolin-7-yl]quinolin-2-yl]naphthalen-2-yl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 164780822 |
| Molecular Formula | C56H34N6 |
| Molecular Weight | 790.93 g/mol |
| Exact Mass | 790.28 |
| IUPAC Name | 2-[6-[7-[2-(4,6-diphenylpyrimidin-2-yl)quinolin-7-yl]quinolin-2-yl]naphthalen-2-yl]-1,10-phenanthroline |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3ccc4ccc(-c5ccc6ccc(-c7ccc8cc(-c9ccc%10ccc%11cccnc%11c%10n9)ccc8c7)nc6c5)cc4n3)n2)cc1 |
| InChI | InChI=1S/C56H34N6/c1-3-8-35(9-4-1)52-34-53(36-10-5-2-6-11-36)62-56(61-52)49-28-24-38-14-18-44(33-51(38)59-49)43-17-13-37-23-26-47(58-50(37)32-43)45-21-19-42-31-46(22-20-41(42)30-45)48-27-25-40-16-15-39-12-7-29-57-54(39)55(40)60-48/h1-34H |
| InChIKey | MAVGMXSXNAMRSY-UHFFFAOYSA-N |
| XLogP | 13.82 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.93 |
| LogP ≤ 5 | 13.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|