C46H28N6 — CID 164779363
2-phenyl-9-[4-[2-(2-pyrimidin-2-ylquinolin-7-yl)quinolin-7-yl]phenyl]-1,10-phenanthroline (PubChem CID 164779363) has the molecular formula C46H28N6 and a molecular weight of 664.77 g/mol. Its IUPAC name is 2-phenyl-9-[4-[2-(2-pyrimidin-2-ylquinolin-7-yl)quinolin-7-yl]phenyl]-1,10-phenanthroline.
| Compound Name | 2-phenyl-9-[4-[2-(2-pyrimidin-2-ylquinolin-7-yl)quinolin-7-yl]phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 164779363 |
| Molecular Formula | C46H28N6 |
| Molecular Weight | 664.77 g/mol |
| Exact Mass | 664.24 |
| IUPAC Name | 2-phenyl-9-[4-[2-(2-pyrimidin-2-ylquinolin-7-yl)quinolin-7-yl]phenyl]-1,10-phenanthroline |
| SMILES | c1ccc(-c2ccc3ccc4ccc(-c5ccc(-c6ccc7ccc(-c8ccc9ccc(-c%10ncccn%10)nc9c8)nc7c6)cc5)nc4c3n2)cc1 |
| InChI | InChI=1S/C46H28N6/c1-2-5-30(6-3-1)38-22-19-34-13-14-35-20-23-39(52-45(35)44(34)51-38)31-9-7-29(8-10-31)36-15-11-32-17-21-40(49-42(32)27-36)37-16-12-33-18-24-41(50-43(33)28-37)46-47-25-4-26-48-46/h1-28H |
| InChIKey | PGLJYCUYECPCIL-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.77 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|