C14H16BClN2O2 — CID 177197500
2-chloro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazoline (PubChem CID 177197500) has the molecular formula C14H16BClN2O2 and a molecular weight of 290.56 g/mol. Its IUPAC name is 2-chloro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazoline.
| Compound Name | 2-chloro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazoline |
|---|---|
| PubChem CID | 177197500 |
| Molecular Formula | C14H16BClN2O2 |
| Molecular Weight | 290.56 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 2-chloro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazoline |
| SMILES | CC1(C)OB(c2ccc3cnc(Cl)nc3c2)OC1(C)C |
| InChI | InChI=1S/C14H16BClN2O2/c1-13(2)14(3,4)20-15(19-13)10-6-5-9-8-17-12(16)18-11(9)7-10/h5-8H,1-4H3 |
| InChIKey | FJRXUUFRKSJOAR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.56 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|