C16H21BN2O4 — CID 142321842
2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxalin-2-yl]oxyethanol (PubChem CID 142321842) has the molecular formula C16H21BN2O4 and a molecular weight of 316.17 g/mol. Its IUPAC name is 2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxalin-2-yl]oxyethanol.
| Compound Name | 2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxalin-2-yl]oxyethanol |
|---|---|
| PubChem CID | 142321842 |
| Molecular Formula | C16H21BN2O4 |
| Molecular Weight | 316.17 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxalin-2-yl]oxyethanol |
| SMILES | CC1(C)OB(c2ccc3ncc(OCCO)nc3c2)OC1(C)C |
| InChI | InChI=1S/C16H21BN2O4/c1-15(2)16(3,4)23-17(22-15)11-5-6-12-13(9-11)19-14(10-18-12)21-8-7-20/h5-6,9-10,20H,7-8H2,1-4H3 |
| InChIKey | RPOGPCPNQZDDOO-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 73.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.17 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|