C17H19BN4O2 — CID 71209305
2-pyrazol-1-yl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxaline (PubChem CID 71209305) has the molecular formula C17H19BN4O2 and a molecular weight of 322.18 g/mol. Its IUPAC name is 2-pyrazol-1-yl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxaline.
| Compound Name | 2-pyrazol-1-yl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxaline |
|---|---|
| PubChem CID | 71209305 |
| Molecular Formula | C17H19BN4O2 |
| Molecular Weight | 322.18 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 2-pyrazol-1-yl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxaline |
| SMILES | CC1(C)OB(c2ccc3ncc(-n4cccn4)nc3c2)OC1(C)C |
| InChI | InChI=1S/C17H19BN4O2/c1-16(2)17(3,4)24-18(23-16)12-6-7-13-14(10-12)21-15(11-19-13)22-9-5-8-20-22/h5-11H,1-4H3 |
| InChIKey | ZXYFXZMHGFMELK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.18 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|