C19H20BN3O3 — CID 166126383
2-pyridin-2-yl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phthalazin-1-one (PubChem CID 166126383) has the molecular formula C19H20BN3O3 and a molecular weight of 349.20 g/mol. Its IUPAC name is 2-pyridin-2-yl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phthalazin-1-one.
| Compound Name | 2-pyridin-2-yl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phthalazin-1-one |
|---|---|
| PubChem CID | 166126383 |
| Molecular Formula | C19H20BN3O3 |
| Molecular Weight | 349.20 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 2-pyridin-2-yl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phthalazin-1-one |
| SMILES | CC1(C)OB(c2ccc3c(=O)n(-c4ccccn4)ncc3c2)OC1(C)C |
| InChI | InChI=1S/C19H20BN3O3/c1-18(2)19(3,4)26-20(25-18)14-8-9-15-13(11-14)12-22-23(17(15)24)16-7-5-6-10-21-16/h5-12H,1-4H3 |
| InChIKey | BQUKVENHNYOUHJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.20 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|