C16H21BN2O3 — CID 171393377
3-ethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazolin-4-one (PubChem CID 171393377) has the molecular formula C16H21BN2O3 and a molecular weight of 300.17 g/mol. Its IUPAC name is 3-ethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazolin-4-one.
| Compound Name | 3-ethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 171393377 |
| Molecular Formula | C16H21BN2O3 |
| Molecular Weight | 300.17 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 3-ethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazolin-4-one |
| SMILES | CCn1cnc2cc(B3OC(C)(C)C(C)(C)O3)ccc2c1=O |
| InChI | InChI=1S/C16H21BN2O3/c1-6-19-10-18-13-9-11(7-8-12(13)14(19)20)17-21-15(2,3)16(4,5)22-17/h7-10H,6H2,1-5H3 |
| InChIKey | JUYGVFWLZOVXCI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.17 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|