C20H28BNO5 — CID 155697737
2-[2-(3-hydroxypropoxy)ethyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinolin-1-one (PubChem CID 155697737) has the molecular formula C20H28BNO5 and a molecular weight of 373.26 g/mol. Its IUPAC name is 2-[2-(3-hydroxypropoxy)ethyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinolin-1-one.
| Compound Name | 2-[2-(3-hydroxypropoxy)ethyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinolin-1-one |
|---|---|
| PubChem CID | 155697737 |
| Molecular Formula | C20H28BNO5 |
| Molecular Weight | 373.26 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 2-[2-(3-hydroxypropoxy)ethyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinolin-1-one |
| SMILES | CC1(C)OB(c2ccc3c(=O)n(CCOCCCO)ccc3c2)OC1(C)C |
| InChI | InChI=1S/C20H28BNO5/c1-19(2)20(3,4)27-21(26-19)16-6-7-17-15(14-16)8-9-22(18(17)24)10-13-25-12-5-11-23/h6-9,14,23H,5,10-13H2,1-4H3 |
| InChIKey | BRUUFUUOXSINRN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|