C14H22BNO4 — CID 170985302
3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]propan-1-ol (PubChem CID 170985302) has the molecular formula C14H22BNO4 and a molecular weight of 279.15 g/mol. Its IUPAC name is 3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]propan-1-ol.
| Compound Name | 3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]propan-1-ol |
|---|---|
| PubChem CID | 170985302 |
| Molecular Formula | C14H22BNO4 |
| Molecular Weight | 279.15 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]propan-1-ol |
| SMILES | CC1(C)OB(c2ccc(OCCCO)nc2)OC1(C)C |
| InChI | InChI=1S/C14H22BNO4/c1-13(2)14(3,4)20-15(19-13)11-6-7-12(16-10-11)18-9-5-8-17/h6-7,10,17H,5,8-9H2,1-4H3 |
| InChIKey | ZVIGPPUIRMYUKS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.15 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|