C17H29BN2O3 — CID 71304214
N,N-diethyl-2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]ethanamine (PubChem CID 71304214) has the molecular formula C17H29BN2O3 and a molecular weight of 320.24 g/mol. Its IUPAC name is N,N-diethyl-2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]ethanamine.
| Compound Name | N,N-diethyl-2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]ethanamine |
|---|---|
| PubChem CID | 71304214 |
| Molecular Formula | C17H29BN2O3 |
| Molecular Weight | 320.24 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | N,N-diethyl-2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]ethanamine |
| SMILES | CCN(CC)CCOc1ccc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C17H29BN2O3/c1-7-20(8-2)11-12-21-15-10-9-14(13-19-15)18-22-16(3,4)17(5,6)23-18/h9-10,13H,7-8,11-12H2,1-6H3 |
| InChIKey | JXSZKQLWTAFZNY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|