C12H19ClN2O — CID 61268981
2-[[5-(chloromethyl)-2-pyridinyl]oxy]-N,N-diethylethanamine (PubChem CID 61268981) has the molecular formula C12H19ClN2O and a molecular weight of 242.75 g/mol. Its IUPAC name is 2-[[5-(chloromethyl)-2-pyridinyl]oxy]-N,N-diethylethanamine.
| Compound Name | 2-[[5-(chloromethyl)-2-pyridinyl]oxy]-N,N-diethylethanamine |
|---|---|
| PubChem CID | 61268981 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-[[5-(chloromethyl)-2-pyridinyl]oxy]-N,N-diethylethanamine |
| SMILES | CCN(CC)CCOc1ccc(CCl)cn1 |
| InChI | InChI=1S/C12H19ClN2O/c1-3-15(4-2)7-8-16-12-6-5-11(9-13)10-14-12/h5-6,10H,3-4,7-9H2,1-2H3 |
| InChIKey | IXPQWCDNZVSARL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|