C17H26BNO5 — CID 170985200
2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 170985200) has the molecular formula C17H26BNO5 and a molecular weight of 335.21 g/mol. Its IUPAC name is 2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 170985200 |
| Molecular Formula | C17H26BNO5 |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CC1(C)OCC(COc2ccc(B3OC(C)(C)C(C)(C)O3)cn2)O1 |
| InChI | InChI=1S/C17H26BNO5/c1-15(2)16(3,4)24-18(23-15)12-7-8-14(19-9-12)20-10-13-11-21-17(5,6)22-13/h7-9,13H,10-11H2,1-6H3 |
| InChIKey | DTKVQXZGBIZDSR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 59.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|