C10H15N3O3 — CID 121350496
5-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyrazin-2-amine (PubChem CID 121350496) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 5-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyrazin-2-amine.
| Compound Name | 5-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyrazin-2-amine |
|---|---|
| PubChem CID | 121350496 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 5-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]pyrazin-2-amine |
| SMILES | CC1(C)OC[C@@H](COc2cnc(N)cn2)O1 |
| InChI | InChI=1S/C10H15N3O3/c1-10(2)15-6-7(16-10)5-14-9-4-12-8(11)3-13-9/h3-4,7H,5-6H2,1-2H3,(H2,11,12)/t7-/m1/s1 |
| InChIKey | PHXGREHLVAUCOB-SSDOTTSWSA-N |
| XLogP | 0.59 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |