C20H32BNO5 — CID 140774783
tert-butyl 3-methyl-3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]butanoate (PubChem CID 140774783) has the molecular formula C20H32BNO5 and a molecular weight of 377.29 g/mol. Its IUPAC name is tert-butyl 3-methyl-3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]butanoate.
| Compound Name | tert-butyl 3-methyl-3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]butanoate |
|---|---|
| PubChem CID | 140774783 |
| Molecular Formula | C20H32BNO5 |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | tert-butyl 3-methyl-3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]butanoate |
| SMILES | CC(C)(C)OC(=O)CC(C)(C)Oc1ccc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C20H32BNO5/c1-17(2,3)25-16(23)12-18(4,5)24-15-11-10-14(13-22-15)21-26-19(6,7)20(8,9)27-21/h10-11,13H,12H2,1-9H3 |
| InChIKey | JQUITNKPPBEXMW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|