C20H33BN2O4 — CID 75487100
tert-butyl N-butyl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate (PubChem CID 75487100) has the molecular formula C20H33BN2O4 and a molecular weight of 376.31 g/mol. Its IUPAC name is tert-butyl N-butyl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-butyl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 75487100 |
| Molecular Formula | C20H33BN2O4 |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | tert-butyl N-butyl-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate |
| SMILES | CCCCN(C(=O)OC(C)(C)C)c1ccc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C20H33BN2O4/c1-9-10-13-23(17(24)25-18(2,3)4)16-12-11-15(14-22-16)21-26-19(5,6)20(7,8)27-21/h11-12,14H,9-10,13H2,1-8H3 |
| InChIKey | QQGSQGDVMMYTRI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|