C14H24N4O2 — CID 170324871
tert-butyl N-(5-amino-2-pyridinyl)-N-[2-(dimethylamino)ethyl]carbamate (PubChem CID 170324871) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is tert-butyl N-(5-amino-2-pyridinyl)-N-[2-(dimethylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-(5-amino-2-pyridinyl)-N-[2-(dimethylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 170324871 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | tert-butyl N-(5-amino-2-pyridinyl)-N-[2-(dimethylamino)ethyl]carbamate |
| SMILES | CN(C)CCN(C(=O)OC(C)(C)C)c1ccc(N)cn1 |
| InChI | InChI=1S/C14H24N4O2/c1-14(2,3)20-13(19)18(9-8-17(4)5)12-7-6-11(15)10-16-12/h6-7,10H,8-9,15H2,1-5H3 |
| InChIKey | RXBANHOWAXBMEM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |