C22H29ClN6O3 — CID 165125866
tert-butyl N-[1-(4-amino-2-methoxyphenyl)-6-chloropyrazolo[4,3-c]pyridin-3-yl]-N-[2-(dimethylamino)ethyl]carbamate (PubChem CID 165125866) has the molecular formula C22H29ClN6O3 and a molecular weight of 460.97 g/mol. Its IUPAC name is tert-butyl N-[1-(4-amino-2-methoxyphenyl)-6-chloropyrazolo[4,3-c]pyridin-3-yl]-N-[2-(dimethylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[1-(4-amino-2-methoxyphenyl)-6-chloropyrazolo[4,3-c]pyridin-3-yl]-N-[2-(dimethylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 165125866 |
| Molecular Formula | C22H29ClN6O3 |
| Molecular Weight | 460.97 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | tert-butyl N-[1-(4-amino-2-methoxyphenyl)-6-chloropyrazolo[4,3-c]pyridin-3-yl]-N-[2-(dimethylamino)ethyl]carbamate |
| SMILES | COc1cc(N)ccc1-n1nc(N(CCN(C)C)C(=O)OC(C)(C)C)c2cnc(Cl)cc21 |
| InChI | InChI=1S/C22H29ClN6O3/c1-22(2,3)32-21(30)28(10-9-27(4)5)20-15-13-25-19(23)12-17(15)29(26-20)16-8-7-14(24)11-18(16)31-6/h7-8,11-13H,9-10,24H2,1-6H3 |
| InChIKey | XMPXKENVTZNITN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.97 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|