C21H30N2O6 — CID 54763818
dimethyl 3-[butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate (PubChem CID 54763818) has the molecular formula C21H30N2O6 and a molecular weight of 406.48 g/mol. Its IUPAC name is dimethyl 3-[butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate.
| Compound Name | dimethyl 3-[butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate |
|---|---|
| PubChem CID | 54763818 |
| Molecular Formula | C21H30N2O6 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | dimethyl 3-[butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-5,7-dihydrocyclopenta[c]pyridine-6,6-dicarboxylate |
| SMILES | CCCCN(C(=O)OC(C)(C)C)c1cc2c(cn1)CC(C(=O)OC)(C(=O)OC)C2 |
| InChI | InChI=1S/C21H30N2O6/c1-7-8-9-23(19(26)29-20(2,3)4)16-10-14-11-21(17(24)27-5,18(25)28-6)12-15(14)13-22-16/h10,13H,7-9,11-12H2,1-6H3 |
| InChIKey | UNVQJEQWRKJNEU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|