C13H19BrN2O3 — CID 156580264
tert-butyl N-(4-bromo-2-pyridinyl)-N-(2-methoxyethyl)carbamate (PubChem CID 156580264) has the molecular formula C13H19BrN2O3 and a molecular weight of 331.21 g/mol. Its IUPAC name is tert-butyl N-(4-bromo-2-pyridinyl)-N-(2-methoxyethyl)carbamate.
| Compound Name | tert-butyl N-(4-bromo-2-pyridinyl)-N-(2-methoxyethyl)carbamate |
|---|---|
| PubChem CID | 156580264 |
| Molecular Formula | C13H19BrN2O3 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | tert-butyl N-(4-bromo-2-pyridinyl)-N-(2-methoxyethyl)carbamate |
| SMILES | COCCN(C(=O)OC(C)(C)C)c1cc(Br)ccn1 |
| InChI | InChI=1S/C13H19BrN2O3/c1-13(2,3)19-12(17)16(7-8-18-4)11-9-10(14)5-6-15-11/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | BIKKGGTVKHICPK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |