C20H23ClN2O5 — CID 54123993
methyl 3-chloro-5-[2-[(2-methylpropan-2-yl)oxycarbonyl-pyridin-2-ylamino]ethoxy]benzoate (PubChem CID 54123993) has the molecular formula C20H23ClN2O5 and a molecular weight of 406.87 g/mol. Its IUPAC name is methyl 3-chloro-5-[2-[(2-methylpropan-2-yl)oxycarbonyl-pyridin-2-ylamino]ethoxy]benzoate.
| Compound Name | methyl 3-chloro-5-[2-[(2-methylpropan-2-yl)oxycarbonyl-pyridin-2-ylamino]ethoxy]benzoate |
|---|---|
| PubChem CID | 54123993 |
| Molecular Formula | C20H23ClN2O5 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | methyl 3-chloro-5-[2-[(2-methylpropan-2-yl)oxycarbonyl-pyridin-2-ylamino]ethoxy]benzoate |
| SMILES | COC(=O)c1cc(Cl)cc(OCCN(C(=O)OC(C)(C)C)c2ccccn2)c1 |
| InChI | InChI=1S/C20H23ClN2O5/c1-20(2,3)28-19(25)23(17-7-5-6-8-22-17)9-10-27-16-12-14(18(24)26-4)11-15(21)13-16/h5-8,11-13H,9-10H2,1-4H3 |
| InChIKey | NPRQQXVPUPGVRI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |